About 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine
1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine (PubChem CID 79779879) has the molecular formula C10H12Cl2N2
and a molecular weight of 231.13 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine.
Molecular Properties
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine |
| PubChem CID | 79779879 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine |
| SMILES | C=CCCC(N)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N2/c1-2-3-4-9(13)10-8(12)5-7(11)6-14-10/h2,5-6,9H,1,3-4,13H2 |
| InChIKey | CTUVEJASBDIANK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine?
The IUPAC name of 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine (CID 79779879) is 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine.
What is the SMILES notation for 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine?
The canonical SMILES for 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine is C=CCCC(N)c1ncc(Cl)cc1Cl.
What is the InChIKey of 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine?
The InChIKey is CTUVEJASBDIANK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2N2/c1-2-3-4-9(13)10-8(12)5-7(11)6-14-10/h2,5-6,9H,1,3-4,13H2.
What are the key properties of 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine?
1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine has a molecular weight of 231.13 g/mol, XLogP of 3.35, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine is sourced from PubChem (CID 79779879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).