C10H12Cl2N2 — CID 79779879
1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine (PubChem CID 79779879) has the molecular formula C10H12Cl2N2 and a molecular weight of 231.13 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 79779879 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)pent-4-en-1-amine |
| SMILES | C=CCCC(N)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N2/c1-2-3-4-9(13)10-8(12)5-7(11)6-14-10/h2,5-6,9H,1,3-4,13H2 |
| InChIKey | CTUVEJASBDIANK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|