C13H19Cl2N3 — CID 107012565
1-(3,5-dichloro-2-pyridinyl)oct-7-enylhydrazine (PubChem CID 107012565) has the molecular formula C13H19Cl2N3 and a molecular weight of 288.22 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)oct-7-enylhydrazine.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)oct-7-enylhydrazine |
|---|---|
| PubChem CID | 107012565 |
| Molecular Formula | C13H19Cl2N3 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)oct-7-enylhydrazine |
| SMILES | C=CCCCCCC(NN)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2N3/c1-2-3-4-5-6-7-12(18-16)13-11(15)8-10(14)9-17-13/h2,8-9,12,18H,1,3-7,16H2 |
| InChIKey | DLSSEYZDGRZTSB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|