C9H9Cl2N3 — CID 105248733
1-(3,5-dichloro-2-pyridinyl)but-3-ynylhydrazine (PubChem CID 105248733) has the molecular formula C9H9Cl2N3 and a molecular weight of 230.10 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)but-3-ynylhydrazine.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)but-3-ynylhydrazine |
|---|---|
| PubChem CID | 105248733 |
| Molecular Formula | C9H9Cl2N3 |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)but-3-ynylhydrazine |
| SMILES | C#CCC(NN)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl2N3/c1-2-3-8(14-12)9-7(11)4-6(10)5-13-9/h1,4-5,8,14H,3,12H2 |
| InChIKey | IIBDLXIWHBQTCG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|