C13H11Cl4N3 — CID 105248609
[2-(3,4-dichlorophenyl)-1-(3,5-dichloro-2-pyridinyl)ethyl]hydrazine (PubChem CID 105248609) has the molecular formula C13H11Cl4N3 and a molecular weight of 351.06 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-1-(3,5-dichloro-2-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-(3,4-dichlorophenyl)-1-(3,5-dichloro-2-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105248609 |
| Molecular Formula | C13H11Cl4N3 |
| Molecular Weight | 351.06 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-1-(3,5-dichloro-2-pyridinyl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Cl)c(Cl)c1)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl4N3/c14-8-5-11(17)13(19-6-8)12(20-18)4-7-1-2-9(15)10(16)3-7/h1-3,5-6,12,20H,4,18H2 |
| InChIKey | ORHCGIAZMNFDOJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.06 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|