C12H12Cl2N4 — CID 105203255
[2-(3,4-dichlorophenyl)-1-pyrazin-2-ylethyl]hydrazine (PubChem CID 105203255) has the molecular formula C12H12Cl2N4 and a molecular weight of 283.16 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-1-pyrazin-2-ylethyl]hydrazine.
| Compound Name | [2-(3,4-dichlorophenyl)-1-pyrazin-2-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105203255 |
| Molecular Formula | C12H12Cl2N4 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-1-pyrazin-2-ylethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Cl)c(Cl)c1)c1cnccn1 |
| InChI | InChI=1S/C12H12Cl2N4/c13-9-2-1-8(5-10(9)14)6-11(18-15)12-7-16-3-4-17-12/h1-5,7,11,18H,6,15H2 |
| InChIKey | LBHMNPNUEMCFSN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|