C9H11N5S — CID 105203291
[1-pyrazin-2-yl-2-(1,3-thiazol-5-yl)ethyl]hydrazine (PubChem CID 105203291) has the molecular formula C9H11N5S and a molecular weight of 221.29 g/mol. Its IUPAC name is [1-pyrazin-2-yl-2-(1,3-thiazol-5-yl)ethyl]hydrazine.
| Compound Name | [1-pyrazin-2-yl-2-(1,3-thiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105203291 |
| Molecular Formula | C9H11N5S |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | [1-pyrazin-2-yl-2-(1,3-thiazol-5-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1cncs1)c1cnccn1 |
| InChI | InChI=1S/C9H11N5S/c10-14-8(3-7-4-12-6-15-7)9-5-11-1-2-13-9/h1-2,4-6,8,14H,3,10H2 |
| InChIKey | KIUPCJJCJWQQGT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|