C11H12BrN3S — CID 62600805
2-(4-bromothiophen-2-yl)-N-methyl-1-pyrazin-2-ylethanamine (PubChem CID 62600805) has the molecular formula C11H12BrN3S and a molecular weight of 298.21 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-N-methyl-1-pyrazin-2-ylethanamine.
| Compound Name | 2-(4-bromothiophen-2-yl)-N-methyl-1-pyrazin-2-ylethanamine |
|---|---|
| PubChem CID | 62600805 |
| Molecular Formula | C11H12BrN3S |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-N-methyl-1-pyrazin-2-ylethanamine |
| SMILES | CNC(Cc1cc(Br)cs1)c1cnccn1 |
| InChI | InChI=1S/C11H12BrN3S/c1-13-10(11-6-14-2-3-15-11)5-9-4-8(12)7-16-9/h2-4,6-7,10,13H,5H2,1H3 |
| InChIKey | MQMUDNLQDRNLHW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |