C8H13N3O — CID 96762763
(3R)-3-(methylamino)-3-pyrazin-2-ylpropan-1-ol (PubChem CID 96762763) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is (3R)-3-(methylamino)-3-pyrazin-2-ylpropan-1-ol.
| Compound Name | (3R)-3-(methylamino)-3-pyrazin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 96762763 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (3R)-3-(methylamino)-3-pyrazin-2-ylpropan-1-ol |
| SMILES | CN[C@H](CCO)c1cnccn1 |
| InChI | InChI=1S/C8H13N3O/c1-9-7(2-5-12)8-6-10-3-4-11-8/h3-4,6-7,9,12H,2,5H2,1H3/t7-/m1/s1 |
| InChIKey | ZHUUQPBEQKSAEN-SSDOTTSWSA-N |
| XLogP | 0.12 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |