C9H15N3O2 — CID 171889622
4-(methylamino)-1-pyrazin-2-ylbutane-1,2-diol (PubChem CID 171889622) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-(methylamino)-1-pyrazin-2-ylbutane-1,2-diol.
| Compound Name | 4-(methylamino)-1-pyrazin-2-ylbutane-1,2-diol |
|---|---|
| PubChem CID | 171889622 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-(methylamino)-1-pyrazin-2-ylbutane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1cnccn1 |
| InChI | InChI=1S/C9H15N3O2/c1-10-3-2-8(13)9(14)7-6-11-4-5-12-7/h4-6,8-10,13-14H,2-3H2,1H3 |
| InChIKey | YEFMOGPTWIAJGI-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |