C7H9BrN2O2 — CID 171859387
3-bromo-1-pyrazin-2-ylpropane-1,2-diol (PubChem CID 171859387) has the molecular formula C7H9BrN2O2 and a molecular weight of 233.06 g/mol. Its IUPAC name is 3-bromo-1-pyrazin-2-ylpropane-1,2-diol.
| Compound Name | 3-bromo-1-pyrazin-2-ylpropane-1,2-diol |
|---|---|
| PubChem CID | 171859387 |
| Molecular Formula | C7H9BrN2O2 |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | 3-bromo-1-pyrazin-2-ylpropane-1,2-diol |
| SMILES | OC(CBr)C(O)c1cnccn1 |
| InChI | InChI=1S/C7H9BrN2O2/c8-3-6(11)7(12)5-4-9-1-2-10-5/h1-2,4,6-7,11-12H,3H2 |
| InChIKey | ZYYIYVWYPWPONI-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|