C9H12BrNO2 — CID 171859479
3-bromo-1-(3-methyl-4-pyridinyl)propane-1,2-diol (PubChem CID 171859479) has the molecular formula C9H12BrNO2 and a molecular weight of 246.10 g/mol. Its IUPAC name is 3-bromo-1-(3-methyl-4-pyridinyl)propane-1,2-diol.
| Compound Name | 3-bromo-1-(3-methyl-4-pyridinyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171859479 |
| Molecular Formula | C9H12BrNO2 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 3-bromo-1-(3-methyl-4-pyridinyl)propane-1,2-diol |
| SMILES | Cc1cnccc1C(O)C(O)CBr |
| InChI | InChI=1S/C9H12BrNO2/c1-6-5-11-3-2-7(6)9(13)8(12)4-10/h2-3,5,8-9,12-13H,4H2,1H3 |
| InChIKey | DWDLPXDHVBEVTI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|