C10H12BrNO4 — CID 171860452
methyl 3-(3-bromo-1,2-dihydroxypropyl)pyridine-4-carboxylate (PubChem CID 171860452) has the molecular formula C10H12BrNO4 and a molecular weight of 290.11 g/mol. Its IUPAC name is methyl 3-(3-bromo-1,2-dihydroxypropyl)pyridine-4-carboxylate.
| Compound Name | methyl 3-(3-bromo-1,2-dihydroxypropyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 171860452 |
| Molecular Formula | C10H12BrNO4 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | methyl 3-(3-bromo-1,2-dihydroxypropyl)pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccncc1C(O)C(O)CBr |
| InChI | InChI=1S/C10H12BrNO4/c1-16-10(15)6-2-3-12-5-7(6)9(14)8(13)4-11/h2-3,5,8-9,13-14H,4H2,1H3 |
| InChIKey | APMUWLAQMMFXBV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|