C10H12ClNO4 — CID 171893897
3-(4-chloro-1,2-dihydroxybutyl)pyridine-4-carboxylic acid (PubChem CID 171893897) has the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. Its IUPAC name is 3-(4-chloro-1,2-dihydroxybutyl)pyridine-4-carboxylic acid.
| Compound Name | 3-(4-chloro-1,2-dihydroxybutyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 171893897 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-(4-chloro-1,2-dihydroxybutyl)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccncc1C(O)C(O)CCCl |
| InChI | InChI=1S/C10H12ClNO4/c11-3-1-8(13)9(14)7-5-12-4-2-6(7)10(15)16/h2,4-5,8-9,13-14H,1,3H2,(H,15,16) |
| InChIKey | WQDYPDSLUOOZDX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|