C11H12ClNO6 — CID 171894716
2-(4-chloro-1,2-dihydroxybutyl)-4-nitrobenzoic acid (PubChem CID 171894716) has the molecular formula C11H12ClNO6 and a molecular weight of 289.67 g/mol. Its IUPAC name is 2-(4-chloro-1,2-dihydroxybutyl)-4-nitrobenzoic acid.
| Compound Name | 2-(4-chloro-1,2-dihydroxybutyl)-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 171894716 |
| Molecular Formula | C11H12ClNO6 |
| Molecular Weight | 289.67 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2-(4-chloro-1,2-dihydroxybutyl)-4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1C(O)C(O)CCCl |
| InChI | InChI=1S/C11H12ClNO6/c12-4-3-9(14)10(15)8-5-6(13(18)19)1-2-7(8)11(16)17/h1-2,5,9-10,14-15H,3-4H2,(H,16,17) |
| InChIKey | QMZPXYDAZRJAJG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.67 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|