C10H12ClNO4S — CID 171874529
1-(2-chloro-5-nitrophenyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171874529) has the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrophenyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(2-chloro-5-nitrophenyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171874529 |
| Molecular Formula | C10H12ClNO4S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 1-(2-chloro-5-nitrophenyl)-4-sulfanylbutane-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(C(O)C(O)CCS)c1 |
| InChI | InChI=1S/C10H12ClNO4S/c11-8-2-1-6(12(15)16)5-7(8)10(14)9(13)3-4-17/h1-2,5,9-10,13-14,17H,3-4H2 |
| InChIKey | MVTVKOZRTNPNEM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|