C11H13N3O4S — CID 171874935
1-(5-nitro-2H-indazol-3-yl)-4-sulfanylbutane-1,2-diol (PubChem CID 171874935) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is 1-(5-nitro-2H-indazol-3-yl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(5-nitro-2H-indazol-3-yl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171874935 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 1-(5-nitro-2H-indazol-3-yl)-4-sulfanylbutane-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc2n[nH]c(C(O)C(O)CCS)c2c1 |
| InChI | InChI=1S/C11H13N3O4S/c15-9(3-4-19)11(16)10-7-5-6(14(17)18)1-2-8(7)12-13-10/h1-2,5,9,11,15-16,19H,3-4H2,(H,12,13) |
| InChIKey | CBPPGBZLQDLTDH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 112.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|