C14H10Br2N6O2 — CID 159473762
3-bromo-2H-indazol-5-amine;3-bromo-5-nitro-2H-indazole (PubChem CID 159473762) has the molecular formula C14H10Br2N6O2 and a molecular weight of 454.08 g/mol. Its IUPAC name is 3-bromo-2H-indazol-5-amine;3-bromo-5-nitro-2H-indazole.
| Compound Name | 3-bromo-2H-indazol-5-amine;3-bromo-5-nitro-2H-indazole |
|---|---|
| PubChem CID | 159473762 |
| Molecular Formula | C14H10Br2N6O2 |
| Molecular Weight | 454.08 g/mol |
| Exact Mass | 451.92 |
| IUPAC Name | 3-bromo-2H-indazol-5-amine;3-bromo-5-nitro-2H-indazole |
| SMILES | Nc1ccc2n[nH]c(Br)c2c1.O=[N+]([O-])c1ccc2n[nH]c(Br)c2c1 |
| InChI | InChI=1S/C7H4BrN3O2.C7H6BrN3/c8-7-5-3-4(11(12)13)1-2-6(5)9-10-7;8-7-5-3-4(9)1-2-6(5)10-11-7/h1-3H,(H,9,10);1-3H,9H2,(H,10,11) |
| InChIKey | LWCUKPXENZUJKR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.08 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|