C7H3BrN4O4 — CID 138559785
3-bromo-5,6-dinitro-2H-indazole (PubChem CID 138559785) has the molecular formula C7H3BrN4O4 and a molecular weight of 287.03 g/mol. Its IUPAC name is 3-bromo-5,6-dinitro-2H-indazole.
| Compound Name | 3-bromo-5,6-dinitro-2H-indazole |
|---|---|
| PubChem CID | 138559785 |
| Molecular Formula | C7H3BrN4O4 |
| Molecular Weight | 287.03 g/mol |
| Exact Mass | 285.93 |
| IUPAC Name | 3-bromo-5,6-dinitro-2H-indazole |
| SMILES | O=[N+]([O-])c1cc2n[nH]c(Br)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H3BrN4O4/c8-7-3-1-5(11(13)14)6(12(15)16)2-4(3)9-10-7/h1-2H,(H,9,10) |
| InChIKey | XZPYSMAGRPNHEI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.03 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|