About sodium;3-chloro-6-nitro-2H-indazole;hydride
sodium;3-chloro-6-nitro-2H-indazole;hydride (PubChem CID 174516913) has the molecular formula C7H5ClN3NaO2
and a molecular weight of 221.58 g/mol. Its IUPAC name is sodium;3-chloro-6-nitro-2H-indazole;hydride.
Molecular Properties
| Compound Name | sodium;3-chloro-6-nitro-2H-indazole;hydride |
| PubChem CID | 174516913 |
| Molecular Formula | C7H5ClN3NaO2 |
| Molecular Weight | 221.58 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | sodium;3-chloro-6-nitro-2H-indazole;hydride |
| SMILES | O=[N+]([O-])c1ccc2c(Cl)[nH]nc2c1.[H-].[Na+] |
| InChI | InChI=1S/C7H4ClN3O2.Na.H/c8-7-5-2-1-4(11(12)13)3-6(5)9-10-7;;/h1-3H,(H,9,10);;/q;+1;-1 |
| InChIKey | QPKGUAXXHLQUNB-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.58 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;3-chloro-6-nitro-2H-indazole;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-chloro-6-nitro-2H-indazole;hydride?
The IUPAC name of sodium;3-chloro-6-nitro-2H-indazole;hydride (CID 174516913) is sodium;3-chloro-6-nitro-2H-indazole;hydride.
What is the SMILES notation for sodium;3-chloro-6-nitro-2H-indazole;hydride?
The canonical SMILES for sodium;3-chloro-6-nitro-2H-indazole;hydride is O=[N+]([O-])c1ccc2c(Cl)[nH]nc2c1.[H-].[Na+].
What is the InChIKey of sodium;3-chloro-6-nitro-2H-indazole;hydride?
The InChIKey is QPKGUAXXHLQUNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN3O2.Na.H/c8-7-5-2-1-4(11(12)13)3-6(5)9-10-7;;/h1-3H,(H,9,10);;/q;+1;-1.
What are the key properties of sodium;3-chloro-6-nitro-2H-indazole;hydride?
sodium;3-chloro-6-nitro-2H-indazole;hydride has a molecular weight of 221.58 g/mol, XLogP of -0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-chloro-6-nitro-2H-indazole;hydride is sourced from PubChem (CID 174516913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).