About ethane;6-nitroquinoxaline
ethane;6-nitroquinoxaline (PubChem CID 143926485) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is ethane;6-nitroquinoxaline.
Molecular Properties
| Compound Name | ethane;6-nitroquinoxaline |
| PubChem CID | 143926485 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | ethane;6-nitroquinoxaline |
| SMILES | CC.O=[N+]([O-])c1ccc2nccnc2c1 |
| InChI | InChI=1S/C8H5N3O2.C2H6/c12-11(13)6-1-2-7-8(5-6)10-4-3-9-7;1-2/h1-5H;1-2H3 |
| InChIKey | HTOMNXBWJRRJFT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;6-nitroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-nitroquinoxaline?
The IUPAC name of ethane;6-nitroquinoxaline (CID 143926485) is ethane;6-nitroquinoxaline.
What is the SMILES notation for ethane;6-nitroquinoxaline?
The canonical SMILES for ethane;6-nitroquinoxaline is CC.O=[N+]([O-])c1ccc2nccnc2c1.
What is the InChIKey of ethane;6-nitroquinoxaline?
The InChIKey is HTOMNXBWJRRJFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O2.C2H6/c12-11(13)6-1-2-7-8(5-6)10-4-3-9-7;1-2/h1-5H;1-2H3.
What are the key properties of ethane;6-nitroquinoxaline?
ethane;6-nitroquinoxaline has a molecular weight of 205.22 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-nitroquinoxaline is sourced from PubChem (CID 143926485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).