About formaldehyde;bis(7-nitroquinoline)
formaldehyde;bis(7-nitroquinoline) (PubChem CID 174420238) has the molecular formula C19H14N4O5
and a molecular weight of 378.34 g/mol. Its IUPAC name is formaldehyde;bis(7-nitroquinoline).
Molecular Properties
| Compound Name | formaldehyde;bis(7-nitroquinoline) |
| PubChem CID | 174420238 |
| Molecular Formula | C19H14N4O5 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | formaldehyde;bis(7-nitroquinoline) |
| SMILES | C=O.O=[N+]([O-])c1ccc2cccnc2c1.O=[N+]([O-])c1ccc2cccnc2c1 |
| InChI | InChI=1S/2C9H6N2O2.CH2O/c2*12-11(13)8-4-3-7-2-1-5-10-9(7)6-8;1-2/h2*1-6H;1H2 |
| InChIKey | QGARDTQFILCDDY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 129.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;bis(7-nitroquinoline) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;bis(7-nitroquinoline)?
The IUPAC name of formaldehyde;bis(7-nitroquinoline) (CID 174420238) is formaldehyde;bis(7-nitroquinoline).
What is the SMILES notation for formaldehyde;bis(7-nitroquinoline)?
The canonical SMILES for formaldehyde;bis(7-nitroquinoline) is C=O.O=[N+]([O-])c1ccc2cccnc2c1.O=[N+]([O-])c1ccc2cccnc2c1.
What is the InChIKey of formaldehyde;bis(7-nitroquinoline)?
The InChIKey is QGARDTQFILCDDY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H6N2O2.CH2O/c2*12-11(13)8-4-3-7-2-1-5-10-9(7)6-8;1-2/h2*1-6H;1H2.
What are the key properties of formaldehyde;bis(7-nitroquinoline)?
formaldehyde;bis(7-nitroquinoline) has a molecular weight of 378.34 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;bis(7-nitroquinoline) is sourced from PubChem (CID 174420238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).