C12H9N3O3 — CID 175111698
nitric acid;1,7-phenanthroline (PubChem CID 175111698) has the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. Its IUPAC name is nitric acid;1,7-phenanthroline.
| Compound Name | nitric acid;1,7-phenanthroline |
|---|---|
| PubChem CID | 175111698 |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | nitric acid;1,7-phenanthroline |
| SMILES | O=[N+]([O-])O.c1cnc2c(c1)ccc1ncccc12 |
| InChI | InChI=1S/C12H8N2.HNO3/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;2-1(3)4/h1-8H;(H,2,3,4) |
| InChIKey | RDMXBOPRMDKZSM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|