About methanol;1,7-phenanthroline
methanol;1,7-phenanthroline (PubChem CID 174496893) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is methanol;1,7-phenanthroline.
Molecular Properties
| Compound Name | methanol;1,7-phenanthroline |
| PubChem CID | 174496893 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | methanol;1,7-phenanthroline |
| SMILES | CO.c1cnc2c(c1)ccc1ncccc12 |
| InChI | InChI=1S/C12H8N2.CH4O/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;1-2/h1-8H;2H,1H3 |
| InChIKey | LAQKBJIITUHOBM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze methanol;1,7-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;1,7-phenanthroline?
The IUPAC name of methanol;1,7-phenanthroline (CID 174496893) is methanol;1,7-phenanthroline.
What is the SMILES notation for methanol;1,7-phenanthroline?
The canonical SMILES for methanol;1,7-phenanthroline is CO.c1cnc2c(c1)ccc1ncccc12.
What is the InChIKey of methanol;1,7-phenanthroline?
The InChIKey is LAQKBJIITUHOBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.CH4O/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;1-2/h1-8H;2H,1H3.
What are the key properties of methanol;1,7-phenanthroline?
methanol;1,7-phenanthroline has a molecular weight of 212.25 g/mol, XLogP of 2.39, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;1,7-phenanthroline is sourced from PubChem (CID 174496893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).