About benzo[f]quinoline;iodomethane
benzo[f]quinoline;iodomethane (PubChem CID 21121996) has the molecular formula C14H12IN
and a molecular weight of 321.16 g/mol. Its IUPAC name is benzo[f]quinoline;iodomethane.
Molecular Properties
| Compound Name | benzo[f]quinoline;iodomethane |
| PubChem CID | 21121996 |
| Molecular Formula | C14H12IN |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | benzo[f]quinoline;iodomethane |
| SMILES | CI.c1ccc2c(c1)ccc1ncccc12 |
| InChI | InChI=1S/C13H9N.CH3I/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13;1-2/h1-9H;1H3 |
| InChIKey | RKSRKVFAONUELA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[f]quinoline;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[f]quinoline;iodomethane?
The IUPAC name of benzo[f]quinoline;iodomethane (CID 21121996) is benzo[f]quinoline;iodomethane.
What is the SMILES notation for benzo[f]quinoline;iodomethane?
The canonical SMILES for benzo[f]quinoline;iodomethane is CI.c1ccc2c(c1)ccc1ncccc12.
What is the InChIKey of benzo[f]quinoline;iodomethane?
The InChIKey is RKSRKVFAONUELA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.CH3I/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13;1-2/h1-9H;1H3.
What are the key properties of benzo[f]quinoline;iodomethane?
benzo[f]quinoline;iodomethane has a molecular weight of 321.16 g/mol, XLogP of 4.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[f]quinoline;iodomethane is sourced from PubChem (CID 21121996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).