About iodomethane;4-methylquinoline
iodomethane;4-methylquinoline (PubChem CID 161278358) has the molecular formula C11H12IN
and a molecular weight of 285.13 g/mol. Its IUPAC name is iodomethane;4-methylquinoline.
Molecular Properties
| Compound Name | iodomethane;4-methylquinoline |
| PubChem CID | 161278358 |
| Molecular Formula | C11H12IN |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | iodomethane;4-methylquinoline |
| SMILES | CI.Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C10H9N.CH3I/c1-8-6-7-11-10-5-3-2-4-9(8)10;1-2/h2-7H,1H3;1H3 |
| InChIKey | VESXVQZNTBBIFK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodomethane;4-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodomethane;4-methylquinoline?
The IUPAC name of iodomethane;4-methylquinoline (CID 161278358) is iodomethane;4-methylquinoline.
What is the SMILES notation for iodomethane;4-methylquinoline?
The canonical SMILES for iodomethane;4-methylquinoline is CI.Cc1ccnc2ccccc12.
What is the InChIKey of iodomethane;4-methylquinoline?
The InChIKey is VESXVQZNTBBIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.CH3I/c1-8-6-7-11-10-5-3-2-4-9(8)10;1-2/h2-7H,1H3;1H3.
What are the key properties of iodomethane;4-methylquinoline?
iodomethane;4-methylquinoline has a molecular weight of 285.13 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iodomethane;4-methylquinoline is sourced from PubChem (CID 161278358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).