About ethane;4-methyl-1,8-naphthyridine
ethane;4-methyl-1,8-naphthyridine (PubChem CID 143124676) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is ethane;4-methyl-1,8-naphthyridine.
Molecular Properties
| Compound Name | ethane;4-methyl-1,8-naphthyridine |
| PubChem CID | 143124676 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | ethane;4-methyl-1,8-naphthyridine |
| SMILES | CC.Cc1ccnc2ncccc12 |
| InChI | InChI=1S/C9H8N2.C2H6/c1-7-4-6-11-9-8(7)3-2-5-10-9;1-2/h2-6H,1H3;1-2H3 |
| InChIKey | RGZPOPUDZOOJSQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-methyl-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-1,8-naphthyridine?
The IUPAC name of ethane;4-methyl-1,8-naphthyridine (CID 143124676) is ethane;4-methyl-1,8-naphthyridine.
What is the SMILES notation for ethane;4-methyl-1,8-naphthyridine?
The canonical SMILES for ethane;4-methyl-1,8-naphthyridine is CC.Cc1ccnc2ncccc12.
What is the InChIKey of ethane;4-methyl-1,8-naphthyridine?
The InChIKey is RGZPOPUDZOOJSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C2H6/c1-7-4-6-11-9-8(7)3-2-5-10-9;1-2/h2-6H,1H3;1-2H3.
What are the key properties of ethane;4-methyl-1,8-naphthyridine?
ethane;4-methyl-1,8-naphthyridine has a molecular weight of 174.25 g/mol, XLogP of 2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-1,8-naphthyridine is sourced from PubChem (CID 143124676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).