C16H17N3 — CID 142519146
ethane;2-methyl-4-phenylpyrido[2,3-d]pyrimidine (PubChem CID 142519146) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is ethane;2-methyl-4-phenylpyrido[2,3-d]pyrimidine.
| Compound Name | ethane;2-methyl-4-phenylpyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 142519146 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | ethane;2-methyl-4-phenylpyrido[2,3-d]pyrimidine |
| SMILES | CC.Cc1nc(-c2ccccc2)c2cccnc2n1 |
| InChI | InChI=1S/C14H11N3.C2H6/c1-10-16-13(11-6-3-2-4-7-11)12-8-5-9-15-14(12)17-10;1-2/h2-9H,1H3;1-2H3 |
| InChIKey | KIKYAJOHCRNGSF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |