About 2,3-diphenylpyrazino[2,3-b]pyrazine
2,3-diphenylpyrazino[2,3-b]pyrazine (PubChem CID 141468009) has the molecular formula C18H12N4
and a molecular weight of 284.32 g/mol. Its IUPAC name is 2,3-diphenylpyrazino[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 2,3-diphenylpyrazino[2,3-b]pyrazine |
| PubChem CID | 141468009 |
| Molecular Formula | C18H12N4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2,3-diphenylpyrazino[2,3-b]pyrazine |
| SMILES | c1ccc(-c2nc3nccnc3nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H12N4/c1-3-7-13(8-4-1)15-16(14-9-5-2-6-10-14)22-18-17(21-15)19-11-12-20-18/h1-12H |
| InChIKey | OOGRPFOQOFYBLB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-diphenylpyrazino[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenylpyrazino[2,3-b]pyrazine?
The IUPAC name of 2,3-diphenylpyrazino[2,3-b]pyrazine (CID 141468009) is 2,3-diphenylpyrazino[2,3-b]pyrazine.
What is the SMILES notation for 2,3-diphenylpyrazino[2,3-b]pyrazine?
The canonical SMILES for 2,3-diphenylpyrazino[2,3-b]pyrazine is c1ccc(-c2nc3nccnc3nc2-c2ccccc2)cc1.
What is the InChIKey of 2,3-diphenylpyrazino[2,3-b]pyrazine?
The InChIKey is OOGRPFOQOFYBLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N4/c1-3-7-13(8-4-1)15-16(14-9-5-2-6-10-14)22-18-17(21-15)19-11-12-20-18/h1-12H.
What are the key properties of 2,3-diphenylpyrazino[2,3-b]pyrazine?
2,3-diphenylpyrazino[2,3-b]pyrazine has a molecular weight of 284.32 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenylpyrazino[2,3-b]pyrazine is sourced from PubChem (CID 141468009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).