About 2,3-diphenylpyrazine;pyridine
2,3-diphenylpyrazine;pyridine (PubChem CID 175017097) has the molecular formula C21H17N3
and a molecular weight of 311.39 g/mol. Its IUPAC name is 2,3-diphenylpyrazine;pyridine.
Molecular Properties
| Compound Name | 2,3-diphenylpyrazine;pyridine |
| PubChem CID | 175017097 |
| Molecular Formula | C21H17N3 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2,3-diphenylpyrazine;pyridine |
| SMILES | c1ccc(-c2nccnc2-c2ccccc2)cc1.c1ccncc1 |
| InChI | InChI=1S/C16H12N2.C5H5N/c1-3-7-13(8-4-1)15-16(18-12-11-17-15)14-9-5-2-6-10-14;1-2-4-6-5-3-1/h1-12H;1-5H |
| InChIKey | QCXWQXBTPLIVOX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-diphenylpyrazine;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenylpyrazine;pyridine?
The IUPAC name of 2,3-diphenylpyrazine;pyridine (CID 175017097) is 2,3-diphenylpyrazine;pyridine.
What is the SMILES notation for 2,3-diphenylpyrazine;pyridine?
The canonical SMILES for 2,3-diphenylpyrazine;pyridine is c1ccc(-c2nccnc2-c2ccccc2)cc1.c1ccncc1.
What is the InChIKey of 2,3-diphenylpyrazine;pyridine?
The InChIKey is QCXWQXBTPLIVOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2.C5H5N/c1-3-7-13(8-4-1)15-16(18-12-11-17-15)14-9-5-2-6-10-14;1-2-4-6-5-3-1/h1-12H;1-5H.
What are the key properties of 2,3-diphenylpyrazine;pyridine?
2,3-diphenylpyrazine;pyridine has a molecular weight of 311.39 g/mol, XLogP of 4.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenylpyrazine;pyridine is sourced from PubChem (CID 175017097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).