C50H34N4 — CID 139681938
2,3,5-triphenyl-6-[4-(3,5,6-triphenylpyrazin-2-yl)phenyl]pyrazine (PubChem CID 139681938) has the molecular formula C50H34N4 and a molecular weight of 690.85 g/mol. Its IUPAC name is 2,3,5-triphenyl-6-[4-(3,5,6-triphenylpyrazin-2-yl)phenyl]pyrazine.
| Compound Name | 2,3,5-triphenyl-6-[4-(3,5,6-triphenylpyrazin-2-yl)phenyl]pyrazine |
|---|---|
| PubChem CID | 139681938 |
| Molecular Formula | C50H34N4 |
| Molecular Weight | 690.85 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | 2,3,5-triphenyl-6-[4-(3,5,6-triphenylpyrazin-2-yl)phenyl]pyrazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)c(-c3ccc(-c4nc(-c5ccccc5)c(-c5ccccc5)nc4-c4ccccc4)cc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C50H34N4/c1-7-19-35(20-8-1)43-45(37-23-11-3-12-24-37)53-49(47(51-43)39-27-15-5-16-28-39)41-31-33-42(34-32-41)50-48(40-29-17-6-18-30-40)52-44(36-21-9-2-10-22-36)46(54-50)38-25-13-4-14-26-38/h1-34H |
| InChIKey | SDYMAZINKRCHGD-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.85 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |