About 2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine
2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine (PubChem CID 58151656) has the molecular formula C36H26N2
and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine.
Molecular Properties
| Compound Name | 2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine |
| PubChem CID | 58151656 |
| Molecular Formula | C36H26N2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine |
| SMILES | C=Cc1ccc(-c2ccc(-c3nc(-c4ccccc4)c(-c4ccccc4)nc3-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C36H26N2/c1-2-26-18-20-27(21-19-26)28-22-24-32(25-23-28)36-35(31-16-10-5-11-17-31)37-33(29-12-6-3-7-13-29)34(38-36)30-14-8-4-9-15-30/h2-25H,1H2 |
| InChIKey | FYCFVEBLJRQNFB-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine?
The IUPAC name of 2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine (CID 58151656) is 2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine.
What is the SMILES notation for 2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine?
The canonical SMILES for 2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine is C=Cc1ccc(-c2ccc(-c3nc(-c4ccccc4)c(-c4ccccc4)nc3-c3ccccc3)cc2)cc1.
What is the InChIKey of 2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine?
The InChIKey is FYCFVEBLJRQNFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H26N2/c1-2-26-18-20-27(21-19-26)28-22-24-32(25-23-28)36-35(31-16-10-5-11-17-31)37-33(29-12-6-3-7-13-29)34(38-36)30-14-8-4-9-15-30/h2-25H,1H2.
What are the key properties of 2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine?
2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine has a molecular weight of 486.62 g/mol, XLogP of 9.45, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-ethenylphenyl)phenyl]-3,5,6-triphenylpyrazine is sourced from PubChem (CID 58151656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).