C43H31N — CID 58151660
4-[4-(4-ethenylphenyl)phenyl]-2,6-bis(4-phenylphenyl)pyridine (PubChem CID 58151660) has the molecular formula C43H31N and a molecular weight of 561.73 g/mol. Its IUPAC name is 4-[4-(4-ethenylphenyl)phenyl]-2,6-bis(4-phenylphenyl)pyridine.
| Compound Name | 4-[4-(4-ethenylphenyl)phenyl]-2,6-bis(4-phenylphenyl)pyridine |
|---|---|
| PubChem CID | 58151660 |
| Molecular Formula | C43H31N |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 4-[4-(4-ethenylphenyl)phenyl]-2,6-bis(4-phenylphenyl)pyridine |
| SMILES | C=Cc1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc(-c5ccccc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C43H31N/c1-2-31-13-15-34(16-14-31)37-17-19-38(20-18-37)41-29-42(39-25-21-35(22-26-39)32-9-5-3-6-10-32)44-43(30-41)40-27-23-36(24-28-40)33-11-7-4-8-12-33/h2-30H,1H2 |
| InChIKey | RVWBIPALKKWXFA-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |