C62H42N4 — CID 167363756
2-phenyl-4-(4-phenylphenyl)-6-[4-[4-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]-1,3,5-triazine (PubChem CID 167363756) has the molecular formula C62H42N4 and a molecular weight of 843.05 g/mol. Its IUPAC name is 2-phenyl-4-(4-phenylphenyl)-6-[4-[4-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(4-phenylphenyl)-6-[4-[4-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 167363756 |
| Molecular Formula | C62H42N4 |
| Molecular Weight | 843.05 g/mol |
| Exact Mass | 842.34 |
| IUPAC Name | 2-phenyl-4-(4-phenylphenyl)-6-[4-[4-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccc(-c6c(-c7ccccc7)c(-c7ccccc7)nc(-c7ccccc7)c6-c6ccccc6)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C62H42N4/c1-7-19-43(20-8-1)44-33-39-53(40-34-44)61-64-60(52-29-17-6-18-30-52)65-62(66-61)54-41-35-46(36-42-54)45-31-37-49(38-32-45)55-56(47-21-9-2-10-22-47)58(50-25-13-4-14-26-50)63-59(51-27-15-5-16-28-51)57(55)48-23-11-3-12-24-48/h1-42H |
| InChIKey | POBJAAONXRDGBT-UHFFFAOYSA-N |
| XLogP | 15.94 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.05 |
| LogP ≤ 5 | 15.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |