C69H47N3 — CID 167363784
4,6-bis(3-phenylphenyl)-2-[4-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]pyrimidine (PubChem CID 167363784) has the molecular formula C69H47N3 and a molecular weight of 918.16 g/mol. Its IUPAC name is 4,6-bis(3-phenylphenyl)-2-[4-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]pyrimidine.
| Compound Name | 4,6-bis(3-phenylphenyl)-2-[4-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 167363784 |
| Molecular Formula | C69H47N3 |
| Molecular Weight | 918.16 g/mol |
| Exact Mass | 917.38 |
| IUPAC Name | 4,6-bis(3-phenylphenyl)-2-[4-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]pyrimidine |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4cccc(-c5ccccc5)c4)nc(-c4ccc(-c5cccc(-c6c(-c7ccccc7)c(-c7ccccc7)nc(-c7ccccc7)c6-c6ccccc6)c5)cc4)n3)c2)cc1 |
| InChI | InChI=1S/C69H47N3/c1-7-22-48(23-8-1)56-34-19-37-59(44-56)62-47-63(60-38-20-35-57(45-60)49-24-9-2-10-25-49)71-69(70-62)55-42-40-50(41-43-55)58-36-21-39-61(46-58)64-65(51-26-11-3-12-27-51)67(53-30-15-5-16-31-53)72-68(54-32-17-6-18-33-54)66(64)52-28-13-4-14-29-52/h1-47H |
| InChIKey | NBRJTVBTZVKFKZ-UHFFFAOYSA-N |
| XLogP | 18.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.16 |
| LogP ≤ 5 | 18.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |