C68H46N4 — CID 167363792
2-(3,5-diphenylphenyl)-4-phenyl-6-[3-[4-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]-1,3,5-triazine (PubChem CID 167363792) has the molecular formula C68H46N4 and a molecular weight of 919.14 g/mol. Its IUPAC name is 2-(3,5-diphenylphenyl)-4-phenyl-6-[3-[4-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2-(3,5-diphenylphenyl)-4-phenyl-6-[3-[4-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 167363792 |
| Molecular Formula | C68H46N4 |
| Molecular Weight | 919.14 g/mol |
| Exact Mass | 918.37 |
| IUPAC Name | 2-(3,5-diphenylphenyl)-4-phenyl-6-[3-[4-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5ccc(-c6c(-c7ccccc7)c(-c7ccccc7)nc(-c7ccccc7)c6-c6ccccc6)cc5)c4)n3)c2)cc1 |
| InChI | InChI=1S/C68H46N4/c1-8-23-47(24-9-1)58-44-59(48-25-10-2-11-26-48)46-60(45-58)68-71-66(55-35-20-7-21-36-55)70-67(72-68)57-38-22-37-56(43-57)49-39-41-52(42-40-49)61-62(50-27-12-3-13-28-50)64(53-31-16-5-17-32-53)69-65(54-33-18-6-19-34-54)63(61)51-29-14-4-15-30-51/h1-46H |
| InChIKey | JCJIHXIYCFKBEP-UHFFFAOYSA-N |
| XLogP | 17.60 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.14 |
| LogP ≤ 5 | 17.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |