C81H55N3 — CID 167363729
2,4-bis(3,5-diphenylphenyl)-6-[4-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]pyrimidine (PubChem CID 167363729) has the molecular formula C81H55N3 and a molecular weight of 1070.35 g/mol. Its IUPAC name is 2,4-bis(3,5-diphenylphenyl)-6-[4-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]pyrimidine.
| Compound Name | 2,4-bis(3,5-diphenylphenyl)-6-[4-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 167363729 |
| Molecular Formula | C81H55N3 |
| Molecular Weight | 1070.35 g/mol |
| Exact Mass | 1069.44 |
| IUPAC Name | 2,4-bis(3,5-diphenylphenyl)-6-[4-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]phenyl]pyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cc(-c4ccc(-c5cccc(-c6c(-c7ccccc7)c(-c7ccccc7)nc(-c7ccccc7)c6-c6ccccc6)c5)cc4)nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)n3)c2)cc1 |
| InChI | InChI=1S/C81H55N3/c1-9-26-56(27-10-1)68-49-69(57-28-11-2-12-29-57)52-72(51-68)75-55-74(82-81(83-75)73-53-70(58-30-13-3-14-31-58)50-71(54-73)59-32-15-4-16-33-59)61-46-44-60(45-47-61)66-42-25-43-67(48-66)76-77(62-34-17-5-18-35-62)79(64-38-21-7-22-39-64)84-80(65-40-23-8-24-41-65)78(76)63-36-19-6-20-37-63/h1-55H |
| InChIKey | ZDQUYBKLFZYDMC-UHFFFAOYSA-N |
| XLogP | 21.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1070.35 |
| LogP ≤ 5 | 21.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |