C63H43N3 — CID 167363684
2,4-bis(3-phenylphenyl)-6-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]pyrimidine (PubChem CID 167363684) has the molecular formula C63H43N3 and a molecular weight of 842.06 g/mol. Its IUPAC name is 2,4-bis(3-phenylphenyl)-6-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]pyrimidine.
| Compound Name | 2,4-bis(3-phenylphenyl)-6-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 167363684 |
| Molecular Formula | C63H43N3 |
| Molecular Weight | 842.06 g/mol |
| Exact Mass | 841.35 |
| IUPAC Name | 2,4-bis(3-phenylphenyl)-6-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]pyrimidine |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4cccc(-c5c(-c6ccccc6)c(-c6ccccc6)nc(-c6ccccc6)c5-c5ccccc5)c4)nc(-c4cccc(-c5ccccc5)c4)n3)c2)cc1 |
| InChI | InChI=1S/C63H43N3/c1-7-22-44(23-8-1)50-34-19-36-52(40-50)56-43-57(65-63(64-56)55-39-20-35-51(41-55)45-24-9-2-10-25-45)53-37-21-38-54(42-53)58-59(46-26-11-3-12-27-46)61(48-30-15-5-16-31-48)66-62(49-32-17-6-18-33-49)60(58)47-28-13-4-14-29-47/h1-43H |
| InChIKey | QQVNMPHGDQSEBQ-UHFFFAOYSA-N |
| XLogP | 16.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.06 |
| LogP ≤ 5 | 16.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |