C48H30N4 — CID 122524491
13-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11,14-diphenyl-12-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene (PubChem CID 122524491) has the molecular formula C48H30N4 and a molecular weight of 662.80 g/mol. Its IUPAC name is 13-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11,14-diphenyl-12-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene.
| Compound Name | 13-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11,14-diphenyl-12-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene |
|---|---|
| PubChem CID | 122524491 |
| Molecular Formula | C48H30N4 |
| Molecular Weight | 662.80 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | 13-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11,14-diphenyl-12-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4nc(-c5ccccc5)c5c(c4-c4ccccc4)-c4cccc6cccc-5c46)cc3)n2)cc1 |
| InChI | InChI=1S/C48H30N4/c1-5-15-32(16-6-1)41-42-38-25-13-23-31-24-14-26-39(40(31)38)43(42)45(33-17-7-2-8-18-33)49-44(41)34-27-29-37(30-28-34)48-51-46(35-19-9-3-10-20-35)50-47(52-48)36-21-11-4-12-22-36/h1-30H |
| InChIKey | ZYBVADHDGAVCGS-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.80 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |