C53H35N5 — CID 156562540
2,4-diphenyl-6-[4-[4-(3,5,6-triphenylpyrazin-2-yl)naphthalen-1-yl]phenyl]-1,3,5-triazine (PubChem CID 156562540) has the molecular formula C53H35N5 and a molecular weight of 741.90 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-[4-(3,5,6-triphenylpyrazin-2-yl)naphthalen-1-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[4-[4-(3,5,6-triphenylpyrazin-2-yl)naphthalen-1-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 156562540 |
| Molecular Formula | C53H35N5 |
| Molecular Weight | 741.90 g/mol |
| Exact Mass | 741.29 |
| IUPAC Name | 2,4-diphenyl-6-[4-[4-(3,5,6-triphenylpyrazin-2-yl)naphthalen-1-yl]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc(-c5nc(-c6ccccc6)c(-c6ccccc6)nc5-c5ccccc5)c5ccccc45)cc3)n2)cc1 |
| InChI | InChI=1S/C53H35N5/c1-6-18-37(19-7-1)47-48(38-20-8-2-9-21-38)55-50(49(54-47)39-22-10-3-11-23-39)46-35-34-43(44-28-16-17-29-45(44)46)36-30-32-42(33-31-36)53-57-51(40-24-12-4-13-25-40)56-52(58-53)41-26-14-5-15-27-41/h1-35H |
| InChIKey | ICIPAFDJTPBACA-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.90 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |