C43H32N6 — CID 158126148
3-[4-[4-(5,6-diphenyl-1,2,4-triazin-3-yl)phenyl]phenyl]-5,6-diphenyl-1,2,4-triazine;methane (PubChem CID 158126148) has the molecular formula C43H32N6 and a molecular weight of 632.77 g/mol. Its IUPAC name is 3-[4-[4-(5,6-diphenyl-1,2,4-triazin-3-yl)phenyl]phenyl]-5,6-diphenyl-1,2,4-triazine;methane.
| Compound Name | 3-[4-[4-(5,6-diphenyl-1,2,4-triazin-3-yl)phenyl]phenyl]-5,6-diphenyl-1,2,4-triazine;methane |
|---|---|
| PubChem CID | 158126148 |
| Molecular Formula | C43H32N6 |
| Molecular Weight | 632.77 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | 3-[4-[4-(5,6-diphenyl-1,2,4-triazin-3-yl)phenyl]phenyl]-5,6-diphenyl-1,2,4-triazine;methane |
| SMILES | C.c1ccc(-c2nnc(-c3ccc(-c4ccc(-c5nnc(-c6ccccc6)c(-c6ccccc6)n5)cc4)cc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C42H28N6.CH4/c1-5-13-31(14-6-1)37-39(33-17-9-3-10-18-33)45-47-41(43-37)35-25-21-29(22-26-35)30-23-27-36(28-24-30)42-44-38(32-15-7-2-8-16-32)40(46-48-42)34-19-11-4-12-20-34;/h1-28H;1H4 |
| InChIKey | FSEVAZYPUOCPMY-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.77 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |