C16H15N5 — CID 6405039
[6-(4-methylphenyl)-3-phenyl-1,2,4-triazin-5-yl]hydrazine (PubChem CID 6405039) has the molecular formula C16H15N5 and a molecular weight of 277.33 g/mol. Its IUPAC name is [6-(4-methylphenyl)-3-phenyl-1,2,4-triazin-5-yl]hydrazine.
| Compound Name | [6-(4-methylphenyl)-3-phenyl-1,2,4-triazin-5-yl]hydrazine |
|---|---|
| PubChem CID | 6405039 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [6-(4-methylphenyl)-3-phenyl-1,2,4-triazin-5-yl]hydrazine |
| SMILES | Cc1ccc(-c2nnc(-c3ccccc3)nc2NN)cc1 |
| InChI | InChI=1S/C16H15N5/c1-11-7-9-12(10-8-11)14-16(19-17)18-15(21-20-14)13-5-3-2-4-6-13/h2-10H,17H2,1H3,(H,18,19,21) |
| InChIKey | JOBAEMNBBASRJH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|