C21H14ClN3 — CID 134997336
5-(4-chlorophenyl)-3,6-diphenyl-1,2,4-triazine (PubChem CID 134997336) has the molecular formula C21H14ClN3 and a molecular weight of 343.82 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3,6-diphenyl-1,2,4-triazine.
| Compound Name | 5-(4-chlorophenyl)-3,6-diphenyl-1,2,4-triazine |
|---|---|
| PubChem CID | 134997336 |
| Molecular Formula | C21H14ClN3 |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 5-(4-chlorophenyl)-3,6-diphenyl-1,2,4-triazine |
| SMILES | Clc1ccc(-c2nc(-c3ccccc3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H14ClN3/c22-18-13-11-16(12-14-18)19-20(15-7-3-1-4-8-15)24-25-21(23-19)17-9-5-2-6-10-17/h1-14H |
| InChIKey | RTELWPUCKJQWFT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |