C33H20ClN5 — CID 156901494
2-[4-[6-(4-chlorophenyl)-3-phenyl-1,2,4-triazin-5-yl]phenyl]-1,10-phenanthroline (PubChem CID 156901494) has the molecular formula C33H20ClN5 and a molecular weight of 522.01 g/mol. Its IUPAC name is 2-[4-[6-(4-chlorophenyl)-3-phenyl-1,2,4-triazin-5-yl]phenyl]-1,10-phenanthroline.
| Compound Name | 2-[4-[6-(4-chlorophenyl)-3-phenyl-1,2,4-triazin-5-yl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 156901494 |
| Molecular Formula | C33H20ClN5 |
| Molecular Weight | 522.01 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 2-[4-[6-(4-chlorophenyl)-3-phenyl-1,2,4-triazin-5-yl]phenyl]-1,10-phenanthroline |
| SMILES | Clc1ccc(-c2nnc(-c3ccccc3)nc2-c2ccc(-c3ccc4ccc5cccnc5c4n3)cc2)cc1 |
| InChI | InChI=1S/C33H20ClN5/c34-27-17-14-25(15-18-27)32-31(37-33(39-38-32)26-5-2-1-3-6-26)23-10-8-21(9-11-23)28-19-16-24-13-12-22-7-4-20-35-29(22)30(24)36-28/h1-20H |
| InChIKey | UMZWLFYMLZCFIT-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.01 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|