C34H20Cl2N4 — CID 21026465
3,7-bis(4-chlorophenyl)-2,8-diphenylpyrazino[2,3-g]quinoxaline (PubChem CID 21026465) has the molecular formula C34H20Cl2N4 and a molecular weight of 555.47 g/mol. Its IUPAC name is 3,7-bis(4-chlorophenyl)-2,8-diphenylpyrazino[2,3-g]quinoxaline.
| Compound Name | 3,7-bis(4-chlorophenyl)-2,8-diphenylpyrazino[2,3-g]quinoxaline |
|---|---|
| PubChem CID | 21026465 |
| Molecular Formula | C34H20Cl2N4 |
| Molecular Weight | 555.47 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | 3,7-bis(4-chlorophenyl)-2,8-diphenylpyrazino[2,3-g]quinoxaline |
| SMILES | Clc1ccc(-c2nc3cc4nc(-c5ccc(Cl)cc5)c(-c5ccccc5)nc4cc3nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H20Cl2N4/c35-25-15-11-23(12-16-25)33-31(21-7-3-1-4-8-21)37-27-19-28-30(20-29(27)39-33)40-34(24-13-17-26(36)18-14-24)32(38-28)22-9-5-2-6-10-22/h1-20H |
| InChIKey | QDTABRPENOCJLV-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.47 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|