C21H17Cl2N3 — CID 87574008
5-chloro-2-(4-chlorophenyl)-3-phenyl-1,6-naphthyridine;methanamine (PubChem CID 87574008) has the molecular formula C21H17Cl2N3 and a molecular weight of 382.29 g/mol. Its IUPAC name is 5-chloro-2-(4-chlorophenyl)-3-phenyl-1,6-naphthyridine;methanamine.
| Compound Name | 5-chloro-2-(4-chlorophenyl)-3-phenyl-1,6-naphthyridine;methanamine |
|---|---|
| PubChem CID | 87574008 |
| Molecular Formula | C21H17Cl2N3 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 5-chloro-2-(4-chlorophenyl)-3-phenyl-1,6-naphthyridine;methanamine |
| SMILES | CN.Clc1ccc(-c2nc3ccnc(Cl)c3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H12Cl2N2.CH5N/c21-15-8-6-14(7-9-15)19-16(13-4-2-1-3-5-13)12-17-18(24-19)10-11-23-20(17)22;1-2/h1-12H;2H2,1H3 |
| InChIKey | QSTZKIQUAGFKCG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|