C23H18ClN3 — CID 58524603
1-[4-(5-chloro-3-phenyl-1,6-naphthyridin-2-yl)phenyl]cyclopropan-1-amine (PubChem CID 58524603) has the molecular formula C23H18ClN3 and a molecular weight of 371.87 g/mol. Its IUPAC name is 1-[4-(5-chloro-3-phenyl-1,6-naphthyridin-2-yl)phenyl]cyclopropan-1-amine.
| Compound Name | 1-[4-(5-chloro-3-phenyl-1,6-naphthyridin-2-yl)phenyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 58524603 |
| Molecular Formula | C23H18ClN3 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 1-[4-(5-chloro-3-phenyl-1,6-naphthyridin-2-yl)phenyl]cyclopropan-1-amine |
| SMILES | NC1(c2ccc(-c3nc4ccnc(Cl)c4cc3-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H18ClN3/c24-22-19-14-18(15-4-2-1-3-5-15)21(27-20(19)10-13-26-22)16-6-8-17(9-7-16)23(25)11-12-23/h1-10,13-14H,11-12,25H2 |
| InChIKey | GMJHSDCVQHFHEZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|