C23H19Cl2N3 — CID 86659516
[1-[4-(5-chloro-3-phenyl-1,6-naphthyridin-2-yl)phenyl]cyclopropyl]azanium chloride (PubChem CID 86659516) has the molecular formula C23H19Cl2N3 and a molecular weight of 408.33 g/mol. Its IUPAC name is [1-[4-(5-chloro-3-phenyl-1,6-naphthyridin-2-yl)phenyl]cyclopropyl]azanium chloride.
| Compound Name | [1-[4-(5-chloro-3-phenyl-1,6-naphthyridin-2-yl)phenyl]cyclopropyl]azanium chloride |
|---|---|
| PubChem CID | 86659516 |
| Molecular Formula | C23H19Cl2N3 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [1-[4-(5-chloro-3-phenyl-1,6-naphthyridin-2-yl)phenyl]cyclopropyl]azanium chloride |
| SMILES | [Cl-].[NH3+]C1(c2ccc(-c3nc4ccnc(Cl)c4cc3-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H18ClN3.ClH/c24-22-19-14-18(15-4-2-1-3-5-15)21(27-20(19)10-13-26-22)16-6-8-17(9-7-16)23(25)11-12-23;/h1-10,13-14H,11-12,25H2;1H |
| InChIKey | TXPGVOFLLVCBLZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 53.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|