C31H30ClN3O4 — CID 90722650
[2-[4-(5-chloro-3-phenyl-1,6-naphthyridin-2-yl)phenyl]-5,8-dioxaspiro[3.4]octan-2-yl] N-tert-butylcarbamate (PubChem CID 90722650) has the molecular formula C31H30ClN3O4 and a molecular weight of 544.05 g/mol. Its IUPAC name is [2-[4-(5-chloro-3-phenyl-1,6-naphthyridin-2-yl)phenyl]-5,8-dioxaspiro[3.4]octan-2-yl] N-tert-butylcarbamate.
| Compound Name | [2-[4-(5-chloro-3-phenyl-1,6-naphthyridin-2-yl)phenyl]-5,8-dioxaspiro[3.4]octan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90722650 |
| Molecular Formula | C31H30ClN3O4 |
| Molecular Weight | 544.05 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | [2-[4-(5-chloro-3-phenyl-1,6-naphthyridin-2-yl)phenyl]-5,8-dioxaspiro[3.4]octan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1(c2ccc(-c3nc4ccnc(Cl)c4cc3-c3ccccc3)cc2)CC2(C1)OCCO2 |
| InChI | InChI=1S/C31H30ClN3O4/c1-29(2,3)35-28(36)39-30(18-31(19-30)37-15-16-38-31)22-11-9-21(10-12-22)26-23(20-7-5-4-6-8-20)17-24-25(34-26)13-14-33-27(24)32/h4-14,17H,15-16,18-19H2,1-3H3,(H,35,36) |
| InChIKey | ORLXBHPLOKYLRI-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.05 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|