C29H28ClN3O2 — CID 90763311
[1-[4-(6-chloro-3-phenyl-1,5-naphthyridin-2-yl)phenyl]cyclobutyl] N-tert-butylcarbamate (PubChem CID 90763311) has the molecular formula C29H28ClN3O2 and a molecular weight of 486.02 g/mol. Its IUPAC name is [1-[4-(6-chloro-3-phenyl-1,5-naphthyridin-2-yl)phenyl]cyclobutyl] N-tert-butylcarbamate.
| Compound Name | [1-[4-(6-chloro-3-phenyl-1,5-naphthyridin-2-yl)phenyl]cyclobutyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90763311 |
| Molecular Formula | C29H28ClN3O2 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | [1-[4-(6-chloro-3-phenyl-1,5-naphthyridin-2-yl)phenyl]cyclobutyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1(c2ccc(-c3nc4ccc(Cl)nc4cc3-c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C29H28ClN3O2/c1-28(2,3)33-27(34)35-29(16-7-17-29)21-12-10-20(11-13-21)26-22(19-8-5-4-6-9-19)18-24-23(32-26)14-15-25(30)31-24/h4-6,8-15,18H,7,16-17H2,1-3H3,(H,33,34) |
| InChIKey | VMEXKQCLKHQJOB-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|