C25H24N4O — CID 71295974
1-tert-butyl-3-(2,3-diphenylquinoxalin-6-yl)urea (PubChem CID 71295974) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,3-diphenylquinoxalin-6-yl)urea.
| Compound Name | 1-tert-butyl-3-(2,3-diphenylquinoxalin-6-yl)urea |
|---|---|
| PubChem CID | 71295974 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-tert-butyl-3-(2,3-diphenylquinoxalin-6-yl)urea |
| SMILES | CC(C)(C)NC(=O)Nc1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C25H24N4O/c1-25(2,3)29-24(30)26-19-14-15-20-21(16-19)28-23(18-12-8-5-9-13-18)22(27-20)17-10-6-4-7-11-17/h4-16H,1-3H3,(H2,26,29,30) |
| InChIKey | MZRAKCFEZXISDL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |